C30H42N6O4 — CID 155499343
19-methyl-6-(3-methylbutanoyl)-11-(2-phenylethyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione (PubChem CID 155499343) has the molecular formula C30H42N6O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is 19-methyl-6-(3-methylbutanoyl)-11-(2-phenylethyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione.
| Compound Name | 19-methyl-6-(3-methylbutanoyl)-11-(2-phenylethyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione |
|---|---|
| PubChem CID | 155499343 |
| Molecular Formula | C30H42N6O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | 19-methyl-6-(3-methylbutanoyl)-11-(2-phenylethyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione |
| SMILES | CC(C)CC(=O)N1CCCC(=O)N(CCc2ccccc2)CC(=O)NC2CCc3c(c(nn3C)C(=O)NCC1)C2 |
| InChI | InChI=1S/C30H42N6O4/c1-21(2)18-28(39)35-15-7-10-27(38)36(16-13-22-8-5-4-6-9-22)20-26(37)32-23-11-12-25-24(19-23)29(33-34(25)3)30(40)31-14-17-35/h4-6,8-9,21,23H,7,10-20H2,1-3H3,(H,31,40)(H,32,37) |
| InChIKey | SDCDTZOHMGONRU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |