C24H41N5O2 — CID 157015363
17-(3-methylbutyl)-7-(2-methylpropyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione (PubChem CID 157015363) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 17-(3-methylbutyl)-7-(2-methylpropyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione.
| Compound Name | 17-(3-methylbutyl)-7-(2-methylpropyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
|---|---|
| PubChem CID | 157015363 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 17-(3-methylbutyl)-7-(2-methylpropyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
| SMILES | CC(C)CCn1nc2c3c1CCC(C3)NC(=O)CCCN(CC(C)C)CCCNC2=O |
| InChI | InChI=1S/C24H41N5O2/c1-17(2)10-14-29-21-9-8-19-15-20(21)23(27-29)24(31)25-11-6-13-28(16-18(3)4)12-5-7-22(30)26-19/h17-19H,5-16H2,1-4H3,(H,25,31)(H,26,30) |
| InChIKey | XWJWWGPWJRONRP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |