C32H42N8O5 — CID 155500090
7-(2,3-dimethylquinoxaline-6-carbonyl)-12-(2-methoxyethyl)-20-methyl-3,7,12,15,20,21-hexazatricyclo[14.5.2.019,22]tricosa-1(21),19(22)-diene-2,11,14-trione (PubChem CID 155500090) has the molecular formula C32H42N8O5 and a molecular weight of 618.74 g/mol. Its IUPAC name is 7-(2,3-dimethylquinoxaline-6-carbonyl)-12-(2-methoxyethyl)-20-methyl-3,7,12,15,20,21-hexazatricyclo[14.5.2.019,22]tricosa-1(21),19(22)-diene-2,11,14-trione.
| Compound Name | 7-(2,3-dimethylquinoxaline-6-carbonyl)-12-(2-methoxyethyl)-20-methyl-3,7,12,15,20,21-hexazatricyclo[14.5.2.019,22]tricosa-1(21),19(22)-diene-2,11,14-trione |
|---|---|
| PubChem CID | 155500090 |
| Molecular Formula | C32H42N8O5 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 7-(2,3-dimethylquinoxaline-6-carbonyl)-12-(2-methoxyethyl)-20-methyl-3,7,12,15,20,21-hexazatricyclo[14.5.2.019,22]tricosa-1(21),19(22)-diene-2,11,14-trione |
| SMILES | COCCN1CC(=O)NC2CCc3c(c(nn3C)C(=O)NCCCN(C(=O)c3ccc4nc(C)c(C)nc4c3)CCCC1=O)C2 |
| InChI | InChI=1S/C32H42N8O5/c1-20-21(2)35-26-17-22(8-10-25(26)34-20)32(44)39-13-5-7-29(42)40(15-16-45-4)19-28(41)36-23-9-11-27-24(18-23)30(37-38(27)3)31(43)33-12-6-14-39/h8,10,17,23H,5-7,9,11-16,18-19H2,1-4H3,(H,33,43)(H,36,41) |
| InChIKey | QLHVMJAAFFOMNC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |