C27H37N5O4 — CID 155503442
12,17-dimethyl-7-(4-phenoxybutanoyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione (PubChem CID 155503442) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 12,17-dimethyl-7-(4-phenoxybutanoyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione.
| Compound Name | 12,17-dimethyl-7-(4-phenoxybutanoyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
|---|---|
| PubChem CID | 155503442 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 12,17-dimethyl-7-(4-phenoxybutanoyl)-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
| SMILES | CN1C(=O)CCCN(C(=O)CCCOc2ccccc2)CCCNC(=O)c2nn(C)c3c2CC1CC3 |
| InChI | InChI=1S/C27H37N5O4/c1-30-20-13-14-23-22(19-20)26(29-31(23)2)27(35)28-15-8-17-32(16-6-11-24(30)33)25(34)12-7-18-36-21-9-4-3-5-10-21/h3-5,9-10,20H,6-8,11-19H2,1-2H3,(H,28,35) |
| InChIKey | ORRLOLHCGMLIKF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|