C27H34ClN5O3 — CID 155918357
7-[(6-chloro-2H-chromen-3-yl)methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione (PubChem CID 155918357) has the molecular formula C27H34ClN5O3 and a molecular weight of 512.05 g/mol. Its IUPAC name is 7-[(6-chloro-2H-chromen-3-yl)methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione.
| Compound Name | 7-[(6-chloro-2H-chromen-3-yl)methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
|---|---|
| PubChem CID | 155918357 |
| Molecular Formula | C27H34ClN5O3 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 7-[(6-chloro-2H-chromen-3-yl)methyl]-12,17-dimethyl-3,7,12,17,18-pentazatricyclo[11.5.2.016,19]icosa-1(18),16(19)-diene-2,11-dione |
| SMILES | CN1C(=O)CCCN(CC2=Cc3cc(Cl)ccc3OC2)CCCNC(=O)c2nn(C)c3c2CC1CC3 |
| InChI | InChI=1S/C27H34ClN5O3/c1-31-21-7-8-23-22(15-21)26(30-32(23)2)27(35)29-10-4-12-33(11-3-5-25(31)34)16-18-13-19-14-20(28)6-9-24(19)36-17-18/h6,9,13-14,21H,3-5,7-8,10-12,15-17H2,1-2H3,(H,29,35) |
| InChIKey | XJRFRNOEUJAVKA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |