C28H39N7O4 — CID 155497612
14,19-dimethyl-11-(2-methylpropyl)-6-(pyridine-4-carbonyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione (PubChem CID 155497612) has the molecular formula C28H39N7O4 and a molecular weight of 537.67 g/mol. Its IUPAC name is 14,19-dimethyl-11-(2-methylpropyl)-6-(pyridine-4-carbonyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione.
| Compound Name | 14,19-dimethyl-11-(2-methylpropyl)-6-(pyridine-4-carbonyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione |
|---|---|
| PubChem CID | 155497612 |
| Molecular Formula | C28H39N7O4 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 14,19-dimethyl-11-(2-methylpropyl)-6-(pyridine-4-carbonyl)-3,6,11,14,19,20-hexazatricyclo[13.5.2.018,21]docosa-1(20),18(21)-diene-2,10,13-trione |
| SMILES | CC(C)CN1CC(=O)N(C)C2CCc3c(c(nn3C)C(=O)NCCN(C(=O)c3ccncc3)CCCC1=O)C2 |
| InChI | InChI=1S/C28H39N7O4/c1-19(2)17-35-18-25(37)32(3)21-7-8-23-22(16-21)26(31-33(23)4)27(38)30-13-15-34(14-5-6-24(35)36)28(39)20-9-11-29-12-10-20/h9-12,19,21H,5-8,13-18H2,1-4H3,(H,30,38) |
| InChIKey | AMLXHYKEFYQBSX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |