C19H21ClN4 — CID 146039646
6-chloro-2-[1-(1-ethylpiperidin-3-yl)imidazol-2-yl]quinoline (PubChem CID 146039646) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is 6-chloro-2-[1-(1-ethylpiperidin-3-yl)imidazol-2-yl]quinoline.
| Compound Name | 6-chloro-2-[1-(1-ethylpiperidin-3-yl)imidazol-2-yl]quinoline |
|---|---|
| PubChem CID | 146039646 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 6-chloro-2-[1-(1-ethylpiperidin-3-yl)imidazol-2-yl]quinoline |
| SMILES | CCN1CCCC(n2ccnc2-c2ccc3cc(Cl)ccc3n2)C1 |
| InChI | InChI=1S/C19H21ClN4/c1-2-23-10-3-4-16(13-23)24-11-9-21-19(24)18-7-5-14-12-15(20)6-8-17(14)22-18/h5-9,11-12,16H,2-4,10,13H2,1H3 |
| InChIKey | REORZYVKSXIKBU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |