C22H29ClN4O2 — CID 45240787
ethyl 4-[1-[(6-chloroquinolin-2-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 45240787) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is ethyl 4-[1-[(6-chloroquinolin-2-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-[(6-chloroquinolin-2-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 45240787 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethyl 4-[1-[(6-chloroquinolin-2-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CCCN(Cc3ccc4cc(Cl)ccc4n3)C2)CC1 |
| InChI | InChI=1S/C22H29ClN4O2/c1-2-29-22(28)27-12-10-26(11-13-27)20-4-3-9-25(16-20)15-19-7-5-17-14-18(23)6-8-21(17)24-19/h5-8,14,20H,2-4,9-13,15-16H2,1H3 |
| InChIKey | FAKHKZNCDDBDDI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |