C28H31ClN4O5 — CID 146042129
8-[2-(3-acetylindol-1-yl)butanoyl]-16-chloro-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione (PubChem CID 146042129) has the molecular formula C28H31ClN4O5 and a molecular weight of 539.03 g/mol. Its IUPAC name is 8-[2-(3-acetylindol-1-yl)butanoyl]-16-chloro-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione.
| Compound Name | 8-[2-(3-acetylindol-1-yl)butanoyl]-16-chloro-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
|---|---|
| PubChem CID | 146042129 |
| Molecular Formula | C28H31ClN4O5 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 8-[2-(3-acetylindol-1-yl)butanoyl]-16-chloro-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
| SMILES | CCC(C(=O)N1CCCNC(=O)c2cc(Cl)ccc2OCCNC(=O)C1)n1cc(C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C28H31ClN4O5/c1-3-23(33-16-22(18(2)34)20-7-4-5-8-24(20)33)28(37)32-13-6-11-31-27(36)21-15-19(29)9-10-25(21)38-14-12-30-26(35)17-32/h4-5,7-10,15-16,23H,3,6,11-14,17H2,1-2H3,(H,30,35)(H,31,36) |
| InChIKey | SGQQHZYVJFIBOG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |