C21H25ClN4O7 — CID 155940087
16-chloro-8-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione;formic acid (PubChem CID 155940087) has the molecular formula C21H25ClN4O7 and a molecular weight of 480.91 g/mol. Its IUPAC name is 16-chloro-8-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione;formic acid.
| Compound Name | 16-chloro-8-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione;formic acid |
|---|---|
| PubChem CID | 155940087 |
| Molecular Formula | C21H25ClN4O7 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 16-chloro-8-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione;formic acid |
| SMILES | Cc1cc(CC(=O)N2CCCNC(=O)c3cc(Cl)ccc3OCCNC(=O)C2)on1.O=CO |
| InChI | InChI=1S/C20H23ClN4O5.CH2O2/c1-13-9-15(30-24-13)11-19(27)25-7-2-5-23-20(28)16-10-14(21)3-4-17(16)29-8-6-22-18(26)12-25;2-1-3/h3-4,9-10H,2,5-8,11-12H2,1H3,(H,22,26)(H,23,28);1H,(H,2,3) |
| InChIKey | QRQPMYCWVCEIHY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 151.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|