C11H22N2O2S — CID 146043161
(1S,3aS,6aS)-1-[(dimethylsulfamoylamino)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 146043161) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is (1S,3aS,6aS)-1-[(dimethylsulfamoylamino)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | (1S,3aS,6aS)-1-[(dimethylsulfamoylamino)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 146043161 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (1S,3aS,6aS)-1-[(dimethylsulfamoylamino)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CN(C)S(=O)(=O)NC[C@H]1CC[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C11H22N2O2S/c1-13(2)16(14,15)12-8-10-7-6-9-4-3-5-11(9)10/h9-12H,3-8H2,1-2H3/t9-,10+,11-/m0/s1 |
| InChIKey | BQISTMXHOAOVKE-AXFHLTTASA-N |
| XLogP | 1.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |