C17H18N4 — CID 146044248
N,4,5-trimethyl-N-(quinolin-8-ylmethyl)pyridazin-3-amine (PubChem CID 146044248) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is N,4,5-trimethyl-N-(quinolin-8-ylmethyl)pyridazin-3-amine.
| Compound Name | N,4,5-trimethyl-N-(quinolin-8-ylmethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 146044248 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N,4,5-trimethyl-N-(quinolin-8-ylmethyl)pyridazin-3-amine |
| SMILES | Cc1cnnc(N(C)Cc2cccc3cccnc23)c1C |
| InChI | InChI=1S/C17H18N4/c1-12-10-19-20-17(13(12)2)21(3)11-15-7-4-6-14-8-5-9-18-16(14)15/h4-10H,11H2,1-3H3 |
| InChIKey | JUNKQQMRKIJGCK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |