C39H31F3O5S2 — CID 14604446
1,3-benzodioxol-5-yl-[4-[bis(phenylsulfanyl)-[4-(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyoxolan-3-yl]methanone (PubChem CID 14604446) has the molecular formula C39H31F3O5S2 and a molecular weight of 700.80 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-[bis(phenylsulfanyl)-[4-(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyoxolan-3-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-[bis(phenylsulfanyl)-[4-(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyoxolan-3-yl]methanone |
|---|---|
| PubChem CID | 14604446 |
| Molecular Formula | C39H31F3O5S2 |
| Molecular Weight | 700.80 g/mol |
| Exact Mass | 700.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-[bis(phenylsulfanyl)-[4-(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyoxolan-3-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)C1COC(OCc2ccccc2)C1C(Sc1ccccc1)(Sc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H31F3O5S2/c40-39(41,42)29-19-17-28(18-20-29)38(48-30-12-6-2-7-13-30,49-31-14-8-3-9-15-31)35-32(24-45-37(35)44-23-26-10-4-1-5-11-26)36(43)27-16-21-33-34(22-27)47-25-46-33/h1-22,32,35,37H,23-25H2 |
| InChIKey | FCCFELFEHHOFHO-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.80 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|