C19H23FN6O2 — CID 146047327
4-(3-fluoro-2-methoxyanilino)-2-methyl-6-(pyridin-2-ylamino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047327) has the molecular formula C19H23FN6O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-(pyridin-2-ylamino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-(pyridin-2-ylamino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047327 |
| Molecular Formula | C19H23FN6O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-(pyridin-2-ylamino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(F)cccc1NC1CC(Nc2ccccn2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C19H23FN6O2/c1-26-19(27)16-13(22-12-7-5-6-11(20)17(12)28-2)10-15(24-18(16)25-26)23-14-8-3-4-9-21-14/h3-9,13,15-16,18,22,24-25H,10H2,1-2H3,(H,21,23) |
| InChIKey | TXZDUFRRBXGOTB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |