C19H21FN8O2 — CID 146047332
6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile (PubChem CID 146047332) has the molecular formula C19H21FN8O2 and a molecular weight of 412.43 g/mol. Its IUPAC name is 6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 146047332 |
| Molecular Formula | C19H21FN8O2 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile |
| SMILES | COc1c(F)cccc1NC1CC(Nc2cncc(C#N)n2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C19H21FN8O2/c1-28-19(29)16-13(24-12-5-3-4-11(20)17(12)30-2)6-14(26-18(16)27-28)25-15-9-22-8-10(7-21)23-15/h3-5,8-9,13-14,16,18,24,26-27H,6H2,1-2H3,(H,23,25) |
| InChIKey | LLLMGQBNNYGKPO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |