C20H22FN7O2 — CID 146047328
6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile (PubChem CID 146047328) has the molecular formula C20H22FN7O2 and a molecular weight of 411.44 g/mol. Its IUPAC name is 6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 146047328 |
| Molecular Formula | C20H22FN7O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 6-[[4-(3-fluoro-2-methoxyanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile |
| SMILES | COc1c(F)cccc1NC1CC(Nc2cccc(C#N)n2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C20H22FN7O2/c1-28-20(29)17-14(24-13-7-4-6-12(21)18(13)30-2)9-16(26-19(17)27-28)25-15-8-3-5-11(10-22)23-15/h3-8,14,16-17,19,24,26-27H,9H2,1-2H3,(H,23,25) |
| InChIKey | ZCWVPYQCDUYCCF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |