C21H25F3N6O3 — CID 146047319
4-[4-(hydroxymethyl)-2-methoxyanilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047319) has the molecular formula C21H25F3N6O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-2-methoxyanilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-[4-(hydroxymethyl)-2-methoxyanilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047319 |
| Molecular Formula | C21H25F3N6O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 4-[4-(hydroxymethyl)-2-methoxyanilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1cc(CO)ccc1NC1CC(Nc2cccc(C(F)(F)F)n2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C21H25F3N6O3/c1-30-20(32)18-13(25-12-7-6-11(10-31)8-14(12)33-2)9-17(28-19(18)29-30)27-16-5-3-4-15(26-16)21(22,23)24/h3-8,13,17-19,25,28-29,31H,9-10H2,1-2H3,(H,26,27) |
| InChIKey | VGBOVJJBEXCXRZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |