C22H28N6O3S — CID 146047389
6-[(5-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047389) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 6-[(5-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 6-[(5-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047389 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 6-[(5-cyclopropyl-2-pyridinyl)amino]-2-methyl-4-(2-methylsulfonylanilino)-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | CN1NC2NC(Nc3ccc(C4CC4)cn3)CC(Nc3ccccc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C22H28N6O3S/c1-28-22(29)20-16(24-15-5-3-4-6-17(15)32(2,30)31)11-19(26-21(20)27-28)25-18-10-9-14(12-23-18)13-7-8-13/h3-6,9-10,12-13,16,19-21,24,26-27H,7-8,11H2,1-2H3,(H,23,25) |
| InChIKey | QDZIIWJEUJINGN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |