C23H27F3N6O3S — CID 146047418
4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047418) has the molecular formula C23H27F3N6O3S and a molecular weight of 524.57 g/mol. Its IUPAC name is 4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047418 |
| Molecular Formula | C23H27F3N6O3S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | CN1NC2NC(Nc3cccc(C(F)(F)F)n3)CC(Nc3ccc(C4CC4)cc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C23H27F3N6O3S/c1-32-22(33)20-15(27-14-9-8-13(12-6-7-12)10-16(14)36(2,34)35)11-19(30-21(20)31-32)29-18-5-3-4-17(28-18)23(24,25)26/h3-5,8-10,12,15,19-21,27,30-31H,6-7,11H2,1-2H3,(H,28,29) |
| InChIKey | MFFNSEQKIZKDTM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |