C20H22ClF3N6O3S — CID 146047412
4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047412) has the molecular formula C20H22ClF3N6O3S and a molecular weight of 518.95 g/mol. Its IUPAC name is 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047412 |
| Molecular Formula | C20H22ClF3N6O3S |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | CN1NC2NC(Nc3cccc(C(F)(F)F)n3)CC(Nc3ccc(Cl)cc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C20H22ClF3N6O3S/c1-30-19(31)17-12(25-11-7-6-10(21)8-13(11)34(2,32)33)9-16(28-18(17)29-30)27-15-5-3-4-14(26-15)20(22,23)24/h3-8,12,16-18,25,28-29H,9H2,1-2H3,(H,26,27) |
| InChIKey | WBWAWKLAQKMECJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |