C20H22ClN7O3S — CID 146047408
6-[[4-(4-chloro-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile (PubChem CID 146047408) has the molecular formula C20H22ClN7O3S and a molecular weight of 475.96 g/mol. Its IUPAC name is 6-[[4-(4-chloro-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 6-[[4-(4-chloro-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 146047408 |
| Molecular Formula | C20H22ClN7O3S |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 6-[[4-(4-chloro-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile |
| SMILES | CN1NC2NC(Nc3cccc(C#N)n3)CC(Nc3ccc(Cl)cc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C20H22ClN7O3S/c1-28-20(29)18-14(24-13-7-6-11(21)8-15(13)32(2,30)31)9-17(26-19(18)27-28)25-16-5-3-4-12(10-22)23-16/h3-8,14,17-19,24,26-27H,9H2,1-2H3,(H,23,25) |
| InChIKey | HOXFPDGWONBQJV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |