C20H26ClN7O3S — CID 146047406
4-(4-chloro-2-methylsulfonylanilino)-6-[(2,6-dimethylpyrimidin-4-yl)amino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047406) has the molecular formula C20H26ClN7O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is 4-(4-chloro-2-methylsulfonylanilino)-6-[(2,6-dimethylpyrimidin-4-yl)amino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(4-chloro-2-methylsulfonylanilino)-6-[(2,6-dimethylpyrimidin-4-yl)amino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047406 |
| Molecular Formula | C20H26ClN7O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 4-(4-chloro-2-methylsulfonylanilino)-6-[(2,6-dimethylpyrimidin-4-yl)amino]-2-methyl-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cc1cc(NC2CC(Nc3ccc(Cl)cc3S(C)(=O)=O)C3C(=O)N(C)NC3N2)nc(C)n1 |
| InChI | InChI=1S/C20H26ClN7O3S/c1-10-7-16(23-11(2)22-10)25-17-9-14(18-19(26-17)27-28(3)20(18)29)24-13-6-5-12(21)8-15(13)32(4,30)31/h5-8,14,17-19,24,26-27H,9H2,1-4H3,(H,22,23,25) |
| InChIKey | RRNMOQQLVBWWDX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |