C19H24ClN7O3S — CID 146047400
4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[(6-methylpyridazin-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047400) has the molecular formula C19H24ClN7O3S and a molecular weight of 465.97 g/mol. Its IUPAC name is 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[(6-methylpyridazin-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[(6-methylpyridazin-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047400 |
| Molecular Formula | C19H24ClN7O3S |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[(6-methylpyridazin-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cc1ccc(NC2CC(Nc3ccc(Cl)cc3S(C)(=O)=O)C3C(=O)N(C)NC3N2)nn1 |
| InChI | InChI=1S/C19H24ClN7O3S/c1-10-4-7-15(25-24-10)22-16-9-13(17-18(23-16)26-27(2)19(17)28)21-12-6-5-11(20)8-14(12)31(3,29)30/h4-8,13,16-18,21,23,26H,9H2,1-3H3,(H,22,25) |
| InChIKey | WOTBMDOGYXAQKQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |