C23H27N7O3S — CID 146047416
6-[[4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 146047416) has the molecular formula C23H27N7O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 6-[[4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146047416 |
| Molecular Formula | C23H27N7O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 6-[[4-(4-cyclopropyl-2-methylsulfonylanilino)-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | CN1NC2NC(Nc3ccc(C#N)cn3)CC(Nc3ccc(C4CC4)cc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C23H27N7O3S/c1-30-23(31)21-17(26-16-7-6-15(14-4-5-14)9-18(16)34(2,32)33)10-20(28-22(21)29-30)27-19-8-3-13(11-24)12-25-19/h3,6-9,12,14,17,20-22,26,28-29H,4-5,10H2,1-2H3,(H,25,27) |
| InChIKey | YTNSIHQRGPFPRT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |