(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride

C7H13ClO4S — CID 146050056

IUPAC(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride
SMILESCC1(C)OCCOC1CS(=O)(=O)Cl
InChIInChI=1S/C7H13ClO4S/c1-7(2)6(5-13(8,9)10)11-3-4-12-7/h6H,3-5H2,1-2H3
InChIKeyIOZAAAGPAVCHCL-UHFFFAOYSA-N
MW228.70 g/mol
LogP0.75
Rot. Bonds2

About (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride

(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride (PubChem CID 146050056) has the molecular formula C7H13ClO4S and a molecular weight of 228.70 g/mol. Its IUPAC name is (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride.

Molecular Properties

Compound Name(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride
PubChem CID146050056
Molecular FormulaC7H13ClO4S
Molecular Weight228.70 g/mol
Exact Mass228.02
IUPAC Name(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride
SMILESCC1(C)OCCOC1CS(=O)(=O)Cl
InChIInChI=1S/C7H13ClO4S/c1-7(2)6(5-13(8,9)10)11-3-4-12-7/h6H,3-5H2,1-2H3
InChIKeyIOZAAAGPAVCHCL-UHFFFAOYSA-N
XLogP0.75
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.70
LogP ≤ 50.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The IUPAC name of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride (CID 146050056) is (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride.
What is the SMILES notation for (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The canonical SMILES for (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride is CC1(C)OCCOC1CS(=O)(=O)Cl.
What is the InChIKey of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The InChIKey is IOZAAAGPAVCHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO4S/c1-7(2)6(5-13(8,9)10)11-3-4-12-7/h6H,3-5H2,1-2H3.
What are the key properties of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride has a molecular weight of 228.70 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride is sourced from PubChem (CID 146050056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).