About (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride
(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride (PubChem CID 146050056) has the molecular formula C7H13ClO4S
and a molecular weight of 228.70 g/mol. Its IUPAC name is (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride.
Analyze (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The IUPAC name of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride (CID 146050056) is (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride.
What is the SMILES notation for (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The canonical SMILES for (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride is CC1(C)OCCOC1CS(=O)(=O)Cl.
What is the InChIKey of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The InChIKey is IOZAAAGPAVCHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO4S/c1-7(2)6(5-13(8,9)10)11-3-4-12-7/h6H,3-5H2,1-2H3.
What are the key properties of (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride has a molecular weight of 228.70 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride is sourced from PubChem (CID 146050056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).