C7H15NO4S — CID 164634173
[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide (PubChem CID 164634173) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is [(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide.
| Compound Name | [(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 164634173 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | [(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide |
| SMILES | CC1(C)COC[C@H](CS(N)(=O)=O)O1 |
| InChI | InChI=1S/C7H15NO4S/c1-7(2)5-11-3-6(12-7)4-13(8,9)10/h6H,3-5H2,1-2H3,(H2,8,9,10)/t6-/m1/s1 |
| InChIKey | MZMSABAZKJMOAD-ZCFIWIBFSA-N |
| XLogP | -0.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |