(2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride

C8H15ClO4S — CID 155970647

IUPAC(2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride
SMILESCC1(C)COCC(C)(CS(=O)(=O)Cl)O1
InChIInChI=1S/C8H15ClO4S/c1-7(2)4-12-5-8(3,13-7)6-14(9,10)11/h4-6H2,1-3H3
InChIKeyGMDXSYBLEHLEDR-UHFFFAOYSA-N
MW242.72 g/mol
LogP1.14
Rot. Bonds2

About (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride

(2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride (PubChem CID 155970647) has the molecular formula C8H15ClO4S and a molecular weight of 242.72 g/mol. Its IUPAC name is (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride.

Molecular Properties

Compound Name(2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride
PubChem CID155970647
Molecular FormulaC8H15ClO4S
Molecular Weight242.72 g/mol
Exact Mass242.04
IUPAC Name(2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride
SMILESCC1(C)COCC(C)(CS(=O)(=O)Cl)O1
InChIInChI=1S/C8H15ClO4S/c1-7(2)4-12-5-8(3,13-7)6-14(9,10)11/h4-6H2,1-3H3
InChIKeyGMDXSYBLEHLEDR-UHFFFAOYSA-N
XLogP1.14
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.72
LogP ≤ 51.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The IUPAC name of (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride (CID 155970647) is (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride.
What is the SMILES notation for (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The canonical SMILES for (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride is CC1(C)COCC(C)(CS(=O)(=O)Cl)O1.
What is the InChIKey of (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
The InChIKey is GMDXSYBLEHLEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO4S/c1-7(2)4-12-5-8(3,13-7)6-14(9,10)11/h4-6H2,1-3H3.
What are the key properties of (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride?
(2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride has a molecular weight of 242.72 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6,6-trimethyl-1,4-dioxan-2-yl)methanesulfonyl chloride is sourced from PubChem (CID 155970647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).