C28H25ClF3N5O5 — CID 146060843
5-[(2-chlorobenzoyl)amino]-2-[4-(2-methylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060843) has the molecular formula C28H25ClF3N5O5 and a molecular weight of 603.99 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]-2-[4-(2-methylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(2-chlorobenzoyl)amino]-2-[4-(2-methylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060843 |
| Molecular Formula | C28H25ClF3N5O5 |
| Molecular Weight | 603.99 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]-2-[4-(2-methylimidazo[4,5-b]pyridin-3-yl)piperidin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc2cccnc2n1C1CCN(c2ccc(NC(=O)c3ccccc3Cl)cc2C(=O)O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H24ClN5O3.C2HF3O2/c1-16-29-22-7-4-12-28-24(22)32(16)18-10-13-31(14-11-18)23-9-8-17(15-20(23)26(34)35)30-25(33)19-5-2-3-6-21(19)27;3-2(4,5)1(6)7/h2-9,12,15,18H,10-11,13-14H2,1H3,(H,30,33)(H,34,35);(H,6,7) |
| InChIKey | KKAHRBFWSUVZBY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.99 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|