C11H18Br2 — CID 14607137
(4R)-7,7-dibromo-1-methyl-4-propan-2-ylbicyclo[4.1.0]heptane (PubChem CID 14607137) has the molecular formula C11H18Br2 and a molecular weight of 310.07 g/mol. Its IUPAC name is (4R)-7,7-dibromo-1-methyl-4-propan-2-ylbicyclo[4.1.0]heptane.
| Compound Name | (4R)-7,7-dibromo-1-methyl-4-propan-2-ylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 14607137 |
| Molecular Formula | C11H18Br2 |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | (4R)-7,7-dibromo-1-methyl-4-propan-2-ylbicyclo[4.1.0]heptane |
| SMILES | CC(C)[C@@H]1CCC2(C)C(C1)C2(Br)Br |
| InChI | InChI=1S/C11H18Br2/c1-7(2)8-4-5-10(3)9(6-8)11(10,12)13/h7-9H,4-6H2,1-3H3/t8-,9?,10?/m1/s1 |
| InChIKey | JTXHYNQBBIJBKM-XNWIYYODSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|