C19H23N3O4 — CID 146072739
(2R,4S)-N-benzyl-4-(morpholine-4-carbonyl)-1-prop-2-enoylazetidine-2-carboxamide (PubChem CID 146072739) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2R,4S)-N-benzyl-4-(morpholine-4-carbonyl)-1-prop-2-enoylazetidine-2-carboxamide.
| Compound Name | (2R,4S)-N-benzyl-4-(morpholine-4-carbonyl)-1-prop-2-enoylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 146072739 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2R,4S)-N-benzyl-4-(morpholine-4-carbonyl)-1-prop-2-enoylazetidine-2-carboxamide |
| SMILES | C=CC(=O)N1[C@@H](C(=O)NCc2ccccc2)C[C@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H23N3O4/c1-2-17(23)22-15(18(24)20-13-14-6-4-3-5-7-14)12-16(22)19(25)21-8-10-26-11-9-21/h2-7,15-16H,1,8-13H2,(H,20,24)/t15-,16+/m1/s1 |
| InChIKey | MSMRPQMQAOFBPY-CVEARBPZSA-N |
| XLogP | 0.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|