C19H22N2O4S — CID 146072819
8-hex-5-ynoyl-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 146072819) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 8-hex-5-ynoyl-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-hex-5-ynoyl-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 146072819 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 8-hex-5-ynoyl-1,1-dioxo-4-phenyl-1λ6-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | C#CCCCC(=O)N1CCC2(CC1)N(c1ccccc1)C(=O)CS2(=O)=O |
| InChI | InChI=1S/C19H22N2O4S/c1-2-3-5-10-17(22)20-13-11-19(12-14-20)21(16-8-6-4-7-9-16)18(23)15-26(19,24)25/h1,4,6-9H,3,5,10-15H2 |
| InChIKey | PYTZSVNBWRXQRZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|