C21H28ClFN6O2 — CID 146073590
2-[(2-chloro-4-fluorophenyl)methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (PubChem CID 146073590) has the molecular formula C21H28ClFN6O2 and a molecular weight of 450.95 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 146073590 |
| Molecular Formula | C21H28ClFN6O2 |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| SMILES | CN1CCN(CCNC(=O)C2CCCn3c2nn(Cc2ccc(F)cc2Cl)c3=O)CC1 |
| InChI | InChI=1S/C21H28ClFN6O2/c1-26-9-11-27(12-10-26)8-6-24-20(30)17-3-2-7-28-19(17)25-29(21(28)31)14-15-4-5-16(23)13-18(15)22/h4-5,13,17H,2-3,6-12,14H2,1H3,(H,24,30) |
| InChIKey | KYYMPUOXICAZRJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |