C20H16ClF3N4O2 — CID 146072230
2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,4-difluorophenyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (PubChem CID 146072230) has the molecular formula C20H16ClF3N4O2 and a molecular weight of 436.82 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,4-difluorophenyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,4-difluorophenyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 146072230 |
| Molecular Formula | C20H16ClF3N4O2 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl]-N-(2,4-difluorophenyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CCCn2c1nn(Cc1ccc(F)cc1Cl)c2=O |
| InChI | InChI=1S/C20H16ClF3N4O2/c21-15-8-12(22)4-3-11(15)10-28-20(30)27-7-1-2-14(18(27)26-28)19(29)25-17-6-5-13(23)9-16(17)24/h3-6,8-9,14H,1-2,7,10H2,(H,25,29) |
| InChIKey | LCPGWARPUBDGHJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |