C18H22ClFN4O3 — CID 146072202
2-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (PubChem CID 146072202) has the molecular formula C18H22ClFN4O3 and a molecular weight of 396.85 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 146072202 |
| Molecular Formula | C18H22ClFN4O3 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methoxypropyl)-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| SMILES | COCCCNC(=O)C1CCCn2c1nn(Cc1c(F)cccc1Cl)c2=O |
| InChI | InChI=1S/C18H22ClFN4O3/c1-27-10-4-8-21-17(25)12-5-3-9-23-16(12)22-24(18(23)26)11-13-14(19)6-2-7-15(13)20/h2,6-7,12H,3-5,8-11H2,1H3,(H,21,25) |
| InChIKey | LISZMYLYTBTVFZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|