C18H22F2N4O2 — CID 146072135
N-(2,2-difluoroethyl)-2-[(2,5-dimethylphenyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (PubChem CID 146072135) has the molecular formula C18H22F2N4O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-[(2,5-dimethylphenyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-2-[(2,5-dimethylphenyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 146072135 |
| Molecular Formula | C18H22F2N4O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-[(2,5-dimethylphenyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2nc3n(c2=O)CCCC3C(=O)NCC(F)F)c1 |
| InChI | InChI=1S/C18H22F2N4O2/c1-11-5-6-12(2)13(8-11)10-24-18(26)23-7-3-4-14(16(23)22-24)17(25)21-9-15(19)20/h5-6,8,14-15H,3-4,7,9-10H2,1-2H3,(H,21,25) |
| InChIKey | LXLWIMAEXRLJPT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |