C25H30N4O2 — CID 146070920
2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-(3-phenylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (PubChem CID 146070920) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-(3-phenylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-(3-phenylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 146070920 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-(3-phenylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2nc3n(c2=O)CCCC3C(=O)NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C25H30N4O2/c1-18-12-13-19(2)21(16-18)17-29-25(31)28-15-7-11-22(23(28)27-29)24(30)26-14-6-10-20-8-4-3-5-9-20/h3-5,8-9,12-13,16,22H,6-7,10-11,14-15,17H2,1-2H3,(H,26,30) |
| InChIKey | IYMBRZIFYQSBFR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|