C27H36N2O — CID 45216913
N-(3-phenylpropyl)-6-[(2,4,5-trimethylphenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 45216913) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is N-(3-phenylpropyl)-6-[(2,4,5-trimethylphenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | N-(3-phenylpropyl)-6-[(2,4,5-trimethylphenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 45216913 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | N-(3-phenylpropyl)-6-[(2,4,5-trimethylphenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | Cc1cc(C)c(CN2CCC3(CC2)CC3C(=O)NCCCc2ccccc2)cc1C |
| InChI | InChI=1S/C27H36N2O/c1-20-16-22(3)24(17-21(20)2)19-29-14-11-27(12-15-29)18-25(27)26(30)28-13-7-10-23-8-5-4-6-9-23/h4-6,8-9,16-17,25H,7,10-15,18-19H2,1-3H3,(H,28,30) |
| InChIKey | YXVPLWQVTZBCIL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|