C24H34N2O — CID 26351280
(2R)-6-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-phenylpropyl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 26351280) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is (2R)-6-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-phenylpropyl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2R)-6-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-phenylpropyl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 26351280 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | (2R)-6-[[(1R)-cyclohex-3-en-1-yl]methyl]-N-(3-phenylpropyl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1CC12CCN(C[C@H]1CC=CCC1)CC2 |
| InChI | InChI=1S/C24H34N2O/c27-23(25-15-7-12-20-8-3-1-4-9-20)22-18-24(22)13-16-26(17-14-24)19-21-10-5-2-6-11-21/h1-5,8-9,21-22H,6-7,10-19H2,(H,25,27)/t21-,22-/m0/s1 |
| InChIKey | ZSEZVSLQLGSHKS-VXKWHMMOSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|