C21H27N3OS — CID 126465408
N-(3-pyridin-4-ylpropyl)-6-(thiophen-2-ylmethyl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 126465408) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is N-(3-pyridin-4-ylpropyl)-6-(thiophen-2-ylmethyl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | N-(3-pyridin-4-ylpropyl)-6-(thiophen-2-ylmethyl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 126465408 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(3-pyridin-4-ylpropyl)-6-(thiophen-2-ylmethyl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCCc1ccncc1)C1CC12CCN(Cc1cccs1)CC2 |
| InChI | InChI=1S/C21H27N3OS/c25-20(23-9-1-3-17-5-10-22-11-6-17)19-15-21(19)7-12-24(13-8-21)16-18-4-2-14-26-18/h2,4-6,10-11,14,19H,1,3,7-9,12-13,15-16H2,(H,23,25) |
| InChIKey | BAXQOBROPZSSOM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|