C23H27N3O2S — CID 42429855
(2S)-N-(3-pyridin-4-ylpropyl)-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 42429855) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is (2S)-N-(3-pyridin-4-ylpropyl)-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-N-(3-pyridin-4-ylpropyl)-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 42429855 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (2S)-N-(3-pyridin-4-ylpropyl)-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCCc1ccncc1)[C@H]1CC12CCN(C(=O)/C=C/c1cccs1)CC2 |
| InChI | InChI=1S/C23H27N3O2S/c27-21(6-5-19-4-2-16-29-19)26-14-9-23(10-15-26)17-20(23)22(28)25-11-1-3-18-7-12-24-13-8-18/h2,4-8,12-13,16,20H,1,3,9-11,14-15,17H2,(H,25,28)/b6-5+/t20-/m1/s1 |
| InChIKey | LAZZFUKLQNNVID-RRFGBZISSA-N |
| XLogP | 3.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|