C29H37N3O2 — CID 45214381
6-(1-phenylcyclohexanecarbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 45214381) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is 6-(1-phenylcyclohexanecarbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | 6-(1-phenylcyclohexanecarbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 45214381 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 6-(1-phenylcyclohexanecarbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCCc1ccncc1)C1CC12CCN(C(=O)C1(c3ccccc3)CCCCC1)CC2 |
| InChI | InChI=1S/C29H37N3O2/c33-26(31-17-7-8-23-11-18-30-19-12-23)25-22-28(25)15-20-32(21-16-28)27(34)29(13-5-2-6-14-29)24-9-3-1-4-10-24/h1,3-4,9-12,18-19,25H,2,5-8,13-17,20-22H2,(H,31,33) |
| InChIKey | HPPGJCKFTRENLH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|