C30H32N4O2 — CID 42166274
(2R)-6-(9-methylcarbazole-3-carbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 42166274) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is (2R)-6-(9-methylcarbazole-3-carbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2R)-6-(9-methylcarbazole-3-carbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 42166274 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (2R)-6-(9-methylcarbazole-3-carbonyl)-N-(3-pyridin-4-ylpropyl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | Cn1c2ccccc2c2cc(C(=O)N3CCC4(CC3)C[C@H]4C(=O)NCCCc3ccncc3)ccc21 |
| InChI | InChI=1S/C30H32N4O2/c1-33-26-7-3-2-6-23(26)24-19-22(8-9-27(24)33)29(36)34-17-12-30(13-18-34)20-25(30)28(35)32-14-4-5-21-10-15-31-16-11-21/h2-3,6-11,15-16,19,25H,4-5,12-14,17-18,20H2,1H3,(H,32,35)/t25-/m0/s1 |
| InChIKey | CCOTVWMNHVWBDA-VWLOTQADSA-N |
| XLogP | 4.72 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|