C27H32N4O — CID 42245962
(2R)-N-(3-phenylpropyl)-6-[(1-phenylpyrazol-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 42245962) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is (2R)-N-(3-phenylpropyl)-6-[(1-phenylpyrazol-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2R)-N-(3-phenylpropyl)-6-[(1-phenylpyrazol-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 42245962 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (2R)-N-(3-phenylpropyl)-6-[(1-phenylpyrazol-4-yl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@@H]1CC12CCN(Cc1cnn(-c3ccccc3)c1)CC2 |
| InChI | InChI=1S/C27H32N4O/c32-26(28-15-7-10-22-8-3-1-4-9-22)25-18-27(25)13-16-30(17-14-27)20-23-19-29-31(21-23)24-11-5-2-6-12-24/h1-6,8-9,11-12,19,21,25H,7,10,13-18,20H2,(H,28,32)/t25-/m0/s1 |
| InChIKey | IZEHCWADTZSELS-VWLOTQADSA-N |
| XLogP | 4.22 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|