C21H23N5O2 — CID 146072114
2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide (PubChem CID 146072114) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 146072114 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]-3-oxo-N-pyridin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-8-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2nc3n(c2=O)CCCC3C(=O)Nc2ccncc2)c1 |
| InChI | InChI=1S/C21H23N5O2/c1-14-5-6-15(2)16(12-14)13-26-21(28)25-11-3-4-18(19(25)24-26)20(27)23-17-7-9-22-10-8-17/h5-10,12,18H,3-4,11,13H2,1-2H3,(H,22,23,27) |
| InChIKey | HTHHCSRCZFXBQL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |