C21H16N8O — CID 146076553
1-pyrido[2,3-d]pyrimidin-4-yl-3-[1-(quinolin-8-ylmethyl)pyrazol-3-yl]urea (PubChem CID 146076553) has the molecular formula C21H16N8O and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-pyrido[2,3-d]pyrimidin-4-yl-3-[1-(quinolin-8-ylmethyl)pyrazol-3-yl]urea.
| Compound Name | 1-pyrido[2,3-d]pyrimidin-4-yl-3-[1-(quinolin-8-ylmethyl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 146076553 |
| Molecular Formula | C21H16N8O |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-pyrido[2,3-d]pyrimidin-4-yl-3-[1-(quinolin-8-ylmethyl)pyrazol-3-yl]urea |
| SMILES | O=C(Nc1ccn(Cc2cccc3cccnc23)n1)Nc1ncnc2ncccc12 |
| InChI | InChI=1S/C21H16N8O/c30-21(27-20-16-7-3-10-23-19(16)24-13-25-20)26-17-8-11-29(28-17)12-15-5-1-4-14-6-2-9-22-18(14)15/h1-11,13H,12H2,(H2,23,24,25,26,27,28,30) |
| InChIKey | IEEPLNCIDKQDLU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |