C13H21ClF2N2O3 — CID 146077061
tert-butyl 2-[[(2-chloroacetyl)amino]methyl]-4,4-difluoro-2-methylpyrrolidine-1-carboxylate (PubChem CID 146077061) has the molecular formula C13H21ClF2N2O3 and a molecular weight of 326.77 g/mol. Its IUPAC name is tert-butyl 2-[[(2-chloroacetyl)amino]methyl]-4,4-difluoro-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(2-chloroacetyl)amino]methyl]-4,4-difluoro-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146077061 |
| Molecular Formula | C13H21ClF2N2O3 |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | tert-butyl 2-[[(2-chloroacetyl)amino]methyl]-4,4-difluoro-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)CC1(C)CNC(=O)CCl |
| InChI | InChI=1S/C13H21ClF2N2O3/c1-11(2,3)21-10(20)18-8-13(15,16)6-12(18,4)7-17-9(19)5-14/h5-8H2,1-4H3,(H,17,19) |
| InChIKey | KRHQBPMIVTYCKE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|