C13H21F2NO4 — CID 134571057
tert-butyl 4,4-difluoro-2-(3-methoxyoxiran-2-yl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 134571057) has the molecular formula C13H21F2NO4 and a molecular weight of 293.31 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-2-(3-methoxyoxiran-2-yl)-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-difluoro-2-(3-methoxyoxiran-2-yl)-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134571057 |
| Molecular Formula | C13H21F2NO4 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | tert-butyl 4,4-difluoro-2-(3-methoxyoxiran-2-yl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | COC1OC1C1(C)CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21F2NO4/c1-11(2,3)20-10(17)16-7-13(14,15)6-12(16,4)8-9(18-5)19-8/h8-9H,6-7H2,1-5H3 |
| InChIKey | RTYOAXTXELXJDR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|