C19H36N2O4 — CID 143288061
ditert-butyl 4,4,6,6-tetramethyldiazepane-1,2-dicarboxylate (PubChem CID 143288061) has the molecular formula C19H36N2O4 and a molecular weight of 356.51 g/mol. Its IUPAC name is ditert-butyl 4,4,6,6-tetramethyldiazepane-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4,4,6,6-tetramethyldiazepane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 143288061 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | ditert-butyl 4,4,6,6-tetramethyldiazepane-1,2-dicarboxylate |
| SMILES | CC1(C)CN(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C19H36N2O4/c1-16(2,3)24-14(22)20-12-18(7,8)11-19(9,10)13-21(20)15(23)25-17(4,5)6/h11-13H2,1-10H3 |
| InChIKey | NWIZBVAZWDELJO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |