C39H74N4O8 — CID 123348269
2-[6,6,8,8,15,15,17,17-octamethyl-4,10,13-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,10,13-tetrazacyclooctadec-1-yl]acetic acid (PubChem CID 123348269) has the molecular formula C39H74N4O8 and a molecular weight of 727.04 g/mol. Its IUPAC name is 2-[6,6,8,8,15,15,17,17-octamethyl-4,10,13-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,10,13-tetrazacyclooctadec-1-yl]acetic acid.
| Compound Name | 2-[6,6,8,8,15,15,17,17-octamethyl-4,10,13-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,10,13-tetrazacyclooctadec-1-yl]acetic acid |
|---|---|
| PubChem CID | 123348269 |
| Molecular Formula | C39H74N4O8 |
| Molecular Weight | 727.04 g/mol |
| Exact Mass | 726.55 |
| IUPAC Name | 2-[6,6,8,8,15,15,17,17-octamethyl-4,10,13-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,10,13-tetrazacyclooctadec-1-yl]acetic acid |
| SMILES | CC1(C)CN(CC(=O)O)CCN(C(=O)OC(C)(C)C)CC(C)(C)CC(C)(C)CN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C39H74N4O8/c1-33(2,3)49-30(46)41-19-18-40(22-29(44)45)25-36(10,11)23-37(12,13)27-42(31(47)50-34(4,5)6)20-21-43(32(48)51-35(7,8)9)28-39(16,17)24-38(14,15)26-41/h18-28H2,1-17H3,(H,44,45) |
| InChIKey | NCCTUDJJBNDWJK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.04 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|