About 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride
2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride (PubChem CID 146077742) has the molecular formula C13H19ClFNO2
and a molecular weight of 275.75 g/mol. Its IUPAC name is 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride |
| PubChem CID | 146077742 |
| Molecular Formula | C13H19ClFNO2 |
| Molecular Weight | 275.75 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride |
| SMILES | CC(C)(C)NCCOC(=O)c1cccc(F)c1.Cl |
| InChI | InChI=1S/C13H18FNO2.ClH/c1-13(2,3)15-7-8-17-12(16)10-5-4-6-11(14)9-10;/h4-6,9,15H,7-8H2,1-3H3;1H |
| InChIKey | NDLNCRCWMIRGTB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.75 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride?
The IUPAC name of 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride (CID 146077742) is 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride.
What is the SMILES notation for 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride?
The canonical SMILES for 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride is CC(C)(C)NCCOC(=O)c1cccc(F)c1.Cl.
What is the InChIKey of 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride?
The InChIKey is NDLNCRCWMIRGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO2.ClH/c1-13(2,3)15-7-8-17-12(16)10-5-4-6-11(14)9-10;/h4-6,9,15H,7-8H2,1-3H3;1H.
What are the key properties of 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride?
2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride has a molecular weight of 275.75 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)ethyl 3-fluorobenzoate;hydrochloride is sourced from PubChem (CID 146077742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).